4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid

C12H13N3O3 — CID 63073725

IUPAC4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid
SMILESO=C(O)c1ccc(OCCCn2cncn2)cc1
InChIInChI=1S/C12H13N3O3/c16-12(17)10-2-4-11(5-3-10)18-7-1-6-15-9-13-8-14-15/h2-5,8-9H,1,6-7H2,(H,16,17)
InChIKeyIWPJGMSOIGKIQY-UHFFFAOYSA-N
MW247.25 g/mol
LogP1.45
Rot. Bonds6

About 4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid

4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid (PubChem CID 63073725) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid.

Molecular Properties

Compound Name4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid
PubChem CID63073725
Molecular FormulaC12H13N3O3
Molecular Weight247.25 g/mol
Exact Mass247.10
IUPAC Name4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid
SMILESO=C(O)c1ccc(OCCCn2cncn2)cc1
InChIInChI=1S/C12H13N3O3/c16-12(17)10-2-4-11(5-3-10)18-7-1-6-15-9-13-8-14-15/h2-5,8-9H,1,6-7H2,(H,16,17)
InChIKeyIWPJGMSOIGKIQY-UHFFFAOYSA-N
XLogP1.45
TPSA77.24 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.25
LogP ≤ 51.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid?
The IUPAC name of 4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid (CID 63073725) is 4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid.
What is the SMILES notation for 4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid?
The canonical SMILES for 4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid is O=C(O)c1ccc(OCCCn2cncn2)cc1.
What is the InChIKey of 4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid?
The InChIKey is IWPJGMSOIGKIQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O3/c16-12(17)10-2-4-11(5-3-10)18-7-1-6-15-9-13-8-14-15/h2-5,8-9H,1,6-7H2,(H,16,17).
What are the key properties of 4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid?
4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid has a molecular weight of 247.25 g/mol, XLogP of 1.45, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1,2,4-triazol-1-yl)propoxy]benzoic acid is sourced from PubChem (CID 63073725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).