C19H21N3O — CID 22009834
1-[4-(4-phenylmethoxyphenyl)butyl]-1,2,4-triazole (PubChem CID 22009834) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-[4-(4-phenylmethoxyphenyl)butyl]-1,2,4-triazole.
| Compound Name | 1-[4-(4-phenylmethoxyphenyl)butyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 22009834 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-[4-(4-phenylmethoxyphenyl)butyl]-1,2,4-triazole |
| SMILES | c1ccc(COc2ccc(CCCCn3cncn3)cc2)cc1 |
| InChI | InChI=1S/C19H21N3O/c1-2-7-18(8-3-1)14-23-19-11-9-17(10-12-19)6-4-5-13-22-16-20-15-21-22/h1-3,7-12,15-16H,4-6,13-14H2 |
| InChIKey | IRDZXNYCKYIDOG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|