C19H19N3O — CID 72705832
1-[cyclopropyl-(4-phenylmethoxyphenyl)methyl]-1,2,4-triazole (PubChem CID 72705832) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-[cyclopropyl-(4-phenylmethoxyphenyl)methyl]-1,2,4-triazole.
| Compound Name | 1-[cyclopropyl-(4-phenylmethoxyphenyl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 72705832 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 1-[cyclopropyl-(4-phenylmethoxyphenyl)methyl]-1,2,4-triazole |
| SMILES | c1ccc(COc2ccc(C(C3CC3)n3cncn3)cc2)cc1 |
| InChI | InChI=1S/C19H19N3O/c1-2-4-15(5-3-1)12-23-18-10-8-17(9-11-18)19(16-6-7-16)22-14-20-13-21-22/h1-5,8-11,13-14,16,19H,6-7,12H2 |
| InChIKey | BOXNZAPVQCNLTH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |