C17H19NO — CID 171211184
(R)-cyclopropyl-(4-phenylmethoxyphenyl)methanamine (PubChem CID 171211184) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is (R)-cyclopropyl-(4-phenylmethoxyphenyl)methanamine.
| Compound Name | (R)-cyclopropyl-(4-phenylmethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 171211184 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (R)-cyclopropyl-(4-phenylmethoxyphenyl)methanamine |
| SMILES | N[C@@H](c1ccc(OCc2ccccc2)cc1)C1CC1 |
| InChI | InChI=1S/C17H19NO/c18-17(14-6-7-14)15-8-10-16(11-9-15)19-12-13-4-2-1-3-5-13/h1-5,8-11,14,17H,6-7,12,18H2/t17-/m1/s1 |
| InChIKey | QRYSJDXPTAHXFB-QGZVFWFLSA-N |
| XLogP | 3.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |