C19H25ClN2O — CID 171314574
(R)-(4-phenylmethoxyphenyl)-piperidin-4-ylmethanamine;hydrochloride (PubChem CID 171314574) has the molecular formula C19H25ClN2O and a molecular weight of 332.88 g/mol. Its IUPAC name is (R)-(4-phenylmethoxyphenyl)-piperidin-4-ylmethanamine;hydrochloride.
| Compound Name | (R)-(4-phenylmethoxyphenyl)-piperidin-4-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171314574 |
| Molecular Formula | C19H25ClN2O |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (R)-(4-phenylmethoxyphenyl)-piperidin-4-ylmethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc(OCc2ccccc2)cc1)C1CCNCC1 |
| InChI | InChI=1S/C19H24N2O.ClH/c20-19(17-10-12-21-13-11-17)16-6-8-18(9-7-16)22-14-15-4-2-1-3-5-15;/h1-9,17,19,21H,10-14,20H2;1H/t19-;/m0./s1 |
| InChIKey | WRZVMTZDKRUPRS-FYZYNONXSA-N |
| XLogP | 3.69 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |