C17H20ClNO — CID 171230787
(S)-cyclopropyl-(4-phenylmethoxyphenyl)methanamine;hydrochloride (PubChem CID 171230787) has the molecular formula C17H20ClNO and a molecular weight of 289.81 g/mol. Its IUPAC name is (S)-cyclopropyl-(4-phenylmethoxyphenyl)methanamine;hydrochloride.
| Compound Name | (S)-cyclopropyl-(4-phenylmethoxyphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171230787 |
| Molecular Formula | C17H20ClNO |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (S)-cyclopropyl-(4-phenylmethoxyphenyl)methanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1ccc(OCc2ccccc2)cc1)C1CC1 |
| InChI | InChI=1S/C17H19NO.ClH/c18-17(14-6-7-14)15-8-10-16(11-9-15)19-12-13-4-2-1-3-5-13;/h1-5,8-11,14,17H,6-7,12,18H2;1H/t17-;/m0./s1 |
| InChIKey | ZAUZWQLXLRZKIL-LMOVPXPDSA-N |
| XLogP | 4.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |