C12H12N4O3 — CID 28788777
4-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid (PubChem CID 28788777) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is 4-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid.
| Compound Name | 4-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 28788777 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 4-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid |
| SMILES | O=C(CCn1cncn1)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C12H12N4O3/c17-11(5-6-16-8-13-7-14-16)15-10-3-1-9(2-4-10)12(18)19/h1-4,7-8H,5-6H2,(H,15,17)(H,18,19) |
| InChIKey | KTLSFGZUFBRILZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |