4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid

C12H11BrN4O3 — CID 107812375

IUPAC4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid
SMILESO=C(CCn1cncn1)Nc1cc(C(=O)O)ccc1Br
InChIInChI=1S/C12H11BrN4O3/c13-9-2-1-8(12(19)20)5-10(9)16-11(18)3-4-17-7-14-6-15-17/h1-2,5-7H,3-4H2,(H,16,18)(H,19,20)
InChIKeyJOTFWZBPILBRQX-UHFFFAOYSA-N
MW339.15 g/mol
LogP1.77
Rot. Bonds5

About 4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid

4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid (PubChem CID 107812375) has the molecular formula C12H11BrN4O3 and a molecular weight of 339.15 g/mol. Its IUPAC name is 4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid.

Molecular Properties

Compound Name4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid
PubChem CID107812375
Molecular FormulaC12H11BrN4O3
Molecular Weight339.15 g/mol
Exact Mass338.00
IUPAC Name4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid
SMILESO=C(CCn1cncn1)Nc1cc(C(=O)O)ccc1Br
InChIInChI=1S/C12H11BrN4O3/c13-9-2-1-8(12(19)20)5-10(9)16-11(18)3-4-17-7-14-6-15-17/h1-2,5-7H,3-4H2,(H,16,18)(H,19,20)
InChIKeyJOTFWZBPILBRQX-UHFFFAOYSA-N
XLogP1.77
TPSA97.11 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500339.15
LogP ≤ 51.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid?
The IUPAC name of 4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid (CID 107812375) is 4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid.
What is the SMILES notation for 4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid?
The canonical SMILES for 4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid is O=C(CCn1cncn1)Nc1cc(C(=O)O)ccc1Br.
What is the InChIKey of 4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid?
The InChIKey is JOTFWZBPILBRQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrN4O3/c13-9-2-1-8(12(19)20)5-10(9)16-11(18)3-4-17-7-14-6-15-17/h1-2,5-7H,3-4H2,(H,16,18)(H,19,20).
What are the key properties of 4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid?
4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid has a molecular weight of 339.15 g/mol, XLogP of 1.77, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid is sourced from PubChem (CID 107812375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).