C12H11FN4O3 — CID 60750143
2-fluoro-5-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid (PubChem CID 60750143) has the molecular formula C12H11FN4O3 and a molecular weight of 278.24 g/mol. Its IUPAC name is 2-fluoro-5-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid.
| Compound Name | 2-fluoro-5-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 60750143 |
| Molecular Formula | C12H11FN4O3 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-fluoro-5-[3-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid |
| SMILES | O=C(CCn1cncn1)Nc1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H11FN4O3/c13-10-2-1-8(5-9(10)12(19)20)16-11(18)3-4-17-7-14-6-15-17/h1-2,5-7H,3-4H2,(H,16,18)(H,19,20) |
| InChIKey | MSILSXKLGWYRJE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |