C18H18N6O2 — CID 24676210
N-[3-(phenylcarbamoylamino)phenyl]-3-(1,2,4-triazol-1-yl)propanamide (PubChem CID 24676210) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is N-[3-(phenylcarbamoylamino)phenyl]-3-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-[3-(phenylcarbamoylamino)phenyl]-3-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 24676210 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N-[3-(phenylcarbamoylamino)phenyl]-3-(1,2,4-triazol-1-yl)propanamide |
| SMILES | O=C(CCn1cncn1)Nc1cccc(NC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C18H18N6O2/c25-17(9-10-24-13-19-12-20-24)21-15-7-4-8-16(11-15)23-18(26)22-14-5-2-1-3-6-14/h1-8,11-13H,9-10H2,(H,21,25)(H2,22,23,26) |
| InChIKey | APPRPBDSCMBNQI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |