C11H13N5O3S — CID 60709326
N-(4-sulfamoylphenyl)-3-(1,2,4-triazol-1-yl)propanamide (PubChem CID 60709326) has the molecular formula C11H13N5O3S and a molecular weight of 295.32 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)-3-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-(4-sulfamoylphenyl)-3-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 60709326 |
| Molecular Formula | C11H13N5O3S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | N-(4-sulfamoylphenyl)-3-(1,2,4-triazol-1-yl)propanamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CCn2cncn2)cc1 |
| InChI | InChI=1S/C11H13N5O3S/c12-20(18,19)10-3-1-9(2-4-10)15-11(17)5-6-16-8-13-7-14-16/h1-4,7-8H,5-6H2,(H,15,17)(H2,12,18,19) |
| InChIKey | QKFFCINAPNRUCH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |