C29H30N6O2 — CID 56988742
benzotriazol-1-yl-[4-[4-[8-(1,2,4-triazol-1-yl)octoxy]phenyl]phenyl]methanone (PubChem CID 56988742) has the molecular formula C29H30N6O2 and a molecular weight of 494.60 g/mol. Its IUPAC name is benzotriazol-1-yl-[4-[4-[8-(1,2,4-triazol-1-yl)octoxy]phenyl]phenyl]methanone.
| Compound Name | benzotriazol-1-yl-[4-[4-[8-(1,2,4-triazol-1-yl)octoxy]phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 56988742 |
| Molecular Formula | C29H30N6O2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | benzotriazol-1-yl-[4-[4-[8-(1,2,4-triazol-1-yl)octoxy]phenyl]phenyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc(OCCCCCCCCn3cncn3)cc2)cc1)n1nnc2ccccc21 |
| InChI | InChI=1S/C29H30N6O2/c36-29(35-28-10-6-5-9-27(28)32-33-35)25-13-11-23(12-14-25)24-15-17-26(18-16-24)37-20-8-4-2-1-3-7-19-34-22-30-21-31-34/h5-6,9-18,21-22H,1-4,7-8,19-20H2 |
| InChIKey | XOLBUNYCZWPIKF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|