C30H36N6O2 — CID 57003578
benzotriazol-1-yl-[6-[4-(4-octoxyphenyl)piperazin-1-yl]-3-pyridinyl]methanone (PubChem CID 57003578) has the molecular formula C30H36N6O2 and a molecular weight of 512.66 g/mol. Its IUPAC name is benzotriazol-1-yl-[6-[4-(4-octoxyphenyl)piperazin-1-yl]-3-pyridinyl]methanone.
| Compound Name | benzotriazol-1-yl-[6-[4-(4-octoxyphenyl)piperazin-1-yl]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 57003578 |
| Molecular Formula | C30H36N6O2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | benzotriazol-1-yl-[6-[4-(4-octoxyphenyl)piperazin-1-yl]-3-pyridinyl]methanone |
| SMILES | CCCCCCCCOc1ccc(N2CCN(c3ccc(C(=O)n4nnc5ccccc54)cn3)CC2)cc1 |
| InChI | InChI=1S/C30H36N6O2/c1-2-3-4-5-6-9-22-38-26-15-13-25(14-16-26)34-18-20-35(21-19-34)29-17-12-24(23-31-29)30(37)36-28-11-8-7-10-27(28)32-33-36/h7-8,10-17,23H,2-6,9,18-22H2,1H3 |
| InChIKey | ANBBNPAEQODCMV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|