C31H38N6O4 — CID 21182411
[6-[4-[4-(8-methoxyoctoxy)phenyl]piperazin-1-yl]-3-pyridinyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone (PubChem CID 21182411) has the molecular formula C31H38N6O4 and a molecular weight of 558.68 g/mol. Its IUPAC name is [6-[4-[4-(8-methoxyoctoxy)phenyl]piperazin-1-yl]-3-pyridinyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone.
| Compound Name | [6-[4-[4-(8-methoxyoctoxy)phenyl]piperazin-1-yl]-3-pyridinyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone |
|---|---|
| PubChem CID | 21182411 |
| Molecular Formula | C31H38N6O4 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | [6-[4-[4-(8-methoxyoctoxy)phenyl]piperazin-1-yl]-3-pyridinyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone |
| SMILES | COCCCCCCCCOc1ccc(N2CCN(c3ccc(C(=O)n4n[n+]([O-])c5ccccc54)cn3)CC2)cc1 |
| InChI | InChI=1S/C31H38N6O4/c1-40-22-8-4-2-3-5-9-23-41-27-15-13-26(14-16-27)34-18-20-35(21-19-34)30-17-12-25(24-32-30)31(38)36-28-10-6-7-11-29(28)37(39)33-36/h6-7,10-17,24H,2-5,8-9,18-23H2,1H3 |
| InChIKey | ZVXPNIMAQJGIEE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 99.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|