C19H22N4O3 — CID 133307554
ethyl 6-[4-(4-carbamoylphenyl)piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 133307554) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is ethyl 6-[4-(4-carbamoylphenyl)piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-(4-carbamoylphenyl)piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133307554 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | ethyl 6-[4-(4-carbamoylphenyl)piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CCN(c3ccc(C(N)=O)cc3)CC2)nc1 |
| InChI | InChI=1S/C19H22N4O3/c1-2-26-19(25)15-5-8-17(21-13-15)23-11-9-22(10-12-23)16-6-3-14(4-7-16)18(20)24/h3-8,13H,2,9-12H2,1H3,(H2,20,24) |
| InChIKey | VIPISPNQSCKTPA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |