C20H23N3O3 — CID 38783932
ethyl 6-[4-(4-methylbenzoyl)piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 38783932) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is ethyl 6-[4-(4-methylbenzoyl)piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-(4-methylbenzoyl)piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 38783932 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | ethyl 6-[4-(4-methylbenzoyl)piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CCN(C(=O)c3ccc(C)cc3)CC2)nc1 |
| InChI | InChI=1S/C20H23N3O3/c1-3-26-20(25)17-8-9-18(21-14-17)22-10-12-23(13-11-22)19(24)16-6-4-15(2)5-7-16/h4-9,14H,3,10-13H2,1-2H3 |
| InChIKey | NNOUZLVKOHRWSY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |