C26H35N3O5 — CID 55578396
ethyl 6-[4-(4-hexoxy-3-methoxybenzoyl)piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 55578396) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is ethyl 6-[4-(4-hexoxy-3-methoxybenzoyl)piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-(4-hexoxy-3-methoxybenzoyl)piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55578396 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | ethyl 6-[4-(4-hexoxy-3-methoxybenzoyl)piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCCCCCOc1ccc(C(=O)N2CCN(c3ccc(C(=O)OCC)cn3)CC2)cc1OC |
| InChI | InChI=1S/C26H35N3O5/c1-4-6-7-8-17-34-22-11-9-20(18-23(22)32-3)25(30)29-15-13-28(14-16-29)24-12-10-21(19-27-24)26(31)33-5-2/h9-12,18-19H,4-8,13-17H2,1-3H3 |
| InChIKey | HTZHGQKWCCPIOM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|