C20H23N3O3 — CID 36730820
ethyl 6-(4-benzoyl-1,4-diazepan-1-yl)pyridine-3-carboxylate (PubChem CID 36730820) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is ethyl 6-(4-benzoyl-1,4-diazepan-1-yl)pyridine-3-carboxylate.
| Compound Name | ethyl 6-(4-benzoyl-1,4-diazepan-1-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 36730820 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | ethyl 6-(4-benzoyl-1,4-diazepan-1-yl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CCCN(C(=O)c3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C20H23N3O3/c1-2-26-20(25)17-9-10-18(21-15-17)22-11-6-12-23(14-13-22)19(24)16-7-4-3-5-8-16/h3-5,7-10,15H,2,6,11-14H2,1H3 |
| InChIKey | MDKGJWLCSMOHQR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |