C19H22ClN3O2 — CID 36553857
ethyl 6-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 36553857) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is ethyl 6-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 36553857 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | ethyl 6-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CCN(c3cc(Cl)ccc3C)CC2)nc1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-3-25-19(24)15-5-7-18(21-13-15)23-10-8-22(9-11-23)17-12-16(20)6-4-14(17)2/h4-7,12-13H,3,8-11H2,1-2H3 |
| InChIKey | FPEHTCKUKBFQLA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |