C27H29ClN4O3 — CID 15994461
ethyl 4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(phenylcarbamoylamino)benzoate (PubChem CID 15994461) has the molecular formula C27H29ClN4O3 and a molecular weight of 493.01 g/mol. Its IUPAC name is ethyl 4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(phenylcarbamoylamino)benzoate.
| Compound Name | ethyl 4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(phenylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 15994461 |
| Molecular Formula | C27H29ClN4O3 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | ethyl 4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-(phenylcarbamoylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCN(c3cc(Cl)ccc3C)CC2)c(NC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C27H29ClN4O3/c1-3-35-26(33)20-10-12-24(23(17-20)30-27(34)29-22-7-5-4-6-8-22)31-13-15-32(16-14-31)25-18-21(28)11-9-19(25)2/h4-12,17-18H,3,13-16H2,1-2H3,(H2,29,30,34) |
| InChIKey | ORAZXBWBHUTHIG-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |