C28H32N4O5 — CID 46371777
ethyl 3-[(3-methoxyphenyl)carbamoylamino]-4-[4-(3-methoxyphenyl)piperazin-1-yl]benzoate (PubChem CID 46371777) has the molecular formula C28H32N4O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is ethyl 3-[(3-methoxyphenyl)carbamoylamino]-4-[4-(3-methoxyphenyl)piperazin-1-yl]benzoate.
| Compound Name | ethyl 3-[(3-methoxyphenyl)carbamoylamino]-4-[4-(3-methoxyphenyl)piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 46371777 |
| Molecular Formula | C28H32N4O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | ethyl 3-[(3-methoxyphenyl)carbamoylamino]-4-[4-(3-methoxyphenyl)piperazin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCN(c3cccc(OC)c3)CC2)c(NC(=O)Nc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C28H32N4O5/c1-4-37-27(33)20-11-12-26(25(17-20)30-28(34)29-21-7-5-9-23(18-21)35-2)32-15-13-31(14-16-32)22-8-6-10-24(19-22)36-3/h5-12,17-19H,4,13-16H2,1-3H3,(H2,29,30,34) |
| InChIKey | XYFKLRHYOPMOGY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |