C20H23ClN4O2 — CID 17459535
N-(5-chloro-2-piperidin-1-ylphenyl)-2-(phenylcarbamoylamino)acetamide (PubChem CID 17459535) has the molecular formula C20H23ClN4O2 and a molecular weight of 386.88 g/mol. Its IUPAC name is N-(5-chloro-2-piperidin-1-ylphenyl)-2-(phenylcarbamoylamino)acetamide.
| Compound Name | N-(5-chloro-2-piperidin-1-ylphenyl)-2-(phenylcarbamoylamino)acetamide |
|---|---|
| PubChem CID | 17459535 |
| Molecular Formula | C20H23ClN4O2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-(5-chloro-2-piperidin-1-ylphenyl)-2-(phenylcarbamoylamino)acetamide |
| SMILES | O=C(CNC(=O)Nc1ccccc1)Nc1cc(Cl)ccc1N1CCCCC1 |
| InChI | InChI=1S/C20H23ClN4O2/c21-15-9-10-18(25-11-5-2-6-12-25)17(13-15)24-19(26)14-22-20(27)23-16-7-3-1-4-8-16/h1,3-4,7-10,13H,2,5-6,11-12,14H2,(H,24,26)(H2,22,23,27) |
| InChIKey | UZHXYEXPPKHNIQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |