C24H23ClN2O — CID 7892275
N-(5-chloro-2-pyrrolidin-1-ylphenyl)-2,2-diphenylacetamide (PubChem CID 7892275) has the molecular formula C24H23ClN2O and a molecular weight of 390.91 g/mol. Its IUPAC name is N-(5-chloro-2-pyrrolidin-1-ylphenyl)-2,2-diphenylacetamide.
| Compound Name | N-(5-chloro-2-pyrrolidin-1-ylphenyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 7892275 |
| Molecular Formula | C24H23ClN2O |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-(5-chloro-2-pyrrolidin-1-ylphenyl)-2,2-diphenylacetamide |
| SMILES | O=C(Nc1cc(Cl)ccc1N1CCCC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23ClN2O/c25-20-13-14-22(27-15-7-8-16-27)21(17-20)26-24(28)23(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-6,9-14,17,23H,7-8,15-16H2,(H,26,28) |
| InChIKey | QOWFOAZEHGDBGL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |