C25H26ClN3O — CID 4120374
2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N,N-diphenylacetamide (PubChem CID 4120374) has the molecular formula C25H26ClN3O and a molecular weight of 419.96 g/mol. Its IUPAC name is 2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N,N-diphenylacetamide.
| Compound Name | 2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 4120374 |
| Molecular Formula | C25H26ClN3O |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N,N-diphenylacetamide |
| SMILES | Cc1ccc(Cl)cc1N1CCN(CC(=O)N(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H26ClN3O/c1-20-12-13-21(26)18-24(20)28-16-14-27(15-17-28)19-25(30)29(22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-13,18H,14-17,19H2,1H3 |
| InChIKey | RMZOPPJWJONNRP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |