C23H30ClN3O — CID 8591270
2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-[(2S)-4-phenylbutan-2-yl]acetamide (PubChem CID 8591270) has the molecular formula C23H30ClN3O and a molecular weight of 399.97 g/mol. Its IUPAC name is 2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-[(2S)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-[(2S)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 8591270 |
| Molecular Formula | C23H30ClN3O |
| Molecular Weight | 399.97 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-[(2S)-4-phenylbutan-2-yl]acetamide |
| SMILES | Cc1ccc(Cl)cc1N1CCN(CC(=O)N[C@@H](C)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30ClN3O/c1-18-8-11-21(24)16-22(18)27-14-12-26(13-15-27)17-23(28)25-19(2)9-10-20-6-4-3-5-7-20/h3-8,11,16,19H,9-10,12-15,17H2,1-2H3,(H,25,28)/t19-/m0/s1 |
| InChIKey | YZCIIAANWZXZES-IBGZPJMESA-N |
| XLogP | 3.91 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.97 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |