C18H21ClN4O2 — CID 133360399
ethyl 6-[4-(2-chloro-4-pyridinyl)-1,4-diazepan-1-yl]pyridine-3-carboxylate (PubChem CID 133360399) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is ethyl 6-[4-(2-chloro-4-pyridinyl)-1,4-diazepan-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-(2-chloro-4-pyridinyl)-1,4-diazepan-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133360399 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | ethyl 6-[4-(2-chloro-4-pyridinyl)-1,4-diazepan-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CCCN(c3ccnc(Cl)c3)CC2)nc1 |
| InChI | InChI=1S/C18H21ClN4O2/c1-2-25-18(24)14-4-5-17(21-13-14)23-9-3-8-22(10-11-23)15-6-7-20-16(19)12-15/h4-7,12-13H,2-3,8-11H2,1H3 |
| InChIKey | FVEUMERZRDOVFF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|