C20H24N4O4 — CID 133359464
ethyl 6-[4-(3-methyl-4-nitrophenyl)-1,4-diazepan-1-yl]pyridine-3-carboxylate (PubChem CID 133359464) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is ethyl 6-[4-(3-methyl-4-nitrophenyl)-1,4-diazepan-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-(3-methyl-4-nitrophenyl)-1,4-diazepan-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133359464 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | ethyl 6-[4-(3-methyl-4-nitrophenyl)-1,4-diazepan-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CCCN(c3ccc([N+](=O)[O-])c(C)c3)CC2)nc1 |
| InChI | InChI=1S/C20H24N4O4/c1-3-28-20(25)16-5-8-19(21-14-16)23-10-4-9-22(11-12-23)17-6-7-18(24(26)27)15(2)13-17/h5-8,13-14H,3-4,9-12H2,1-2H3 |
| InChIKey | AXMTWQDKLXAMMJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|