C34H42N6O2 — CID 56996781
benzotriazol-1-yl-[4-[4-[1-(4-hexoxyphenyl)piperidin-4-yl]piperazin-1-yl]phenyl]methanone (PubChem CID 56996781) has the molecular formula C34H42N6O2 and a molecular weight of 566.75 g/mol. Its IUPAC name is benzotriazol-1-yl-[4-[4-[1-(4-hexoxyphenyl)piperidin-4-yl]piperazin-1-yl]phenyl]methanone.
| Compound Name | benzotriazol-1-yl-[4-[4-[1-(4-hexoxyphenyl)piperidin-4-yl]piperazin-1-yl]phenyl]methanone |
|---|---|
| PubChem CID | 56996781 |
| Molecular Formula | C34H42N6O2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | benzotriazol-1-yl-[4-[4-[1-(4-hexoxyphenyl)piperidin-4-yl]piperazin-1-yl]phenyl]methanone |
| SMILES | CCCCCCOc1ccc(N2CCC(N3CCN(c4ccc(C(=O)n5nnc6ccccc65)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C34H42N6O2/c1-2-3-4-7-26-42-31-16-14-29(15-17-31)37-20-18-30(19-21-37)39-24-22-38(23-25-39)28-12-10-27(11-13-28)34(41)40-33-9-6-5-8-32(33)35-36-40/h5-6,8-17,30H,2-4,7,18-26H2,1H3 |
| InChIKey | KFGWNVHDAZKSDI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 66.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|