C22H34N2O2 — CID 22713170
4-[4-(4-pentylcyclohexyl)piperazin-1-yl]benzoic acid (PubChem CID 22713170) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 4-[4-(4-pentylcyclohexyl)piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-(4-pentylcyclohexyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 22713170 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 4-[4-(4-pentylcyclohexyl)piperazin-1-yl]benzoic acid |
| SMILES | CCCCCC1CCC(N2CCN(c3ccc(C(=O)O)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H34N2O2/c1-2-3-4-5-18-6-10-20(11-7-18)23-14-16-24(17-15-23)21-12-8-19(9-13-21)22(25)26/h8-9,12-13,18,20H,2-7,10-11,14-17H2,1H3,(H,25,26) |
| InChIKey | LWUKXCANBQSJDW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|