C15H20N2O4S — CID 52983630
4-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]benzoic acid (PubChem CID 52983630) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is 4-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 52983630 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 4-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCN(C3CCS(=O)(=O)C3)CC2)cc1 |
| InChI | InChI=1S/C15H20N2O4S/c18-15(19)12-1-3-13(4-2-12)16-6-8-17(9-7-16)14-5-10-22(20,21)11-14/h1-4,14H,5-11H2,(H,18,19) |
| InChIKey | OCFUMPVNNJSMMF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |