C14H19FN2O2S — CID 7304650
(3R)-3-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide (PubChem CID 7304650) has the molecular formula C14H19FN2O2S and a molecular weight of 298.38 g/mol. Its IUPAC name is (3R)-3-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide.
| Compound Name | (3R)-3-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 7304650 |
| Molecular Formula | C14H19FN2O2S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (3R)-3-[4-(4-fluorophenyl)piperazin-1-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@@H](N2CCN(c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C14H19FN2O2S/c15-12-1-3-13(4-2-12)16-6-8-17(9-7-16)14-5-10-20(18,19)11-14/h1-4,14H,5-11H2/t14-/m1/s1 |
| InChIKey | DIEMLVRHXIZQGI-CQSZACIVSA-N |
| XLogP | 1.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |