C14H21N3O2S — CID 61058786
2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]aniline (PubChem CID 61058786) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]aniline.
| Compound Name | 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]aniline |
|---|---|
| PubChem CID | 61058786 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]aniline |
| SMILES | Nc1ccccc1N1CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C14H21N3O2S/c15-13-3-1-2-4-14(13)17-8-6-16(7-9-17)12-5-10-20(18,19)11-12/h1-4,12H,5-11,15H2 |
| InChIKey | KNHZGAHAISZECO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|