C15H19N3O2S2 — CID 56810040
3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]thiolane 1,1-dioxide (PubChem CID 56810040) has the molecular formula C15H19N3O2S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 56810040 |
| Molecular Formula | C15H19N3O2S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(N2CCN(c3nc4ccccc4s3)CC2)C1 |
| InChI | InChI=1S/C15H19N3O2S2/c19-22(20)10-5-12(11-22)17-6-8-18(9-7-17)15-16-13-3-1-2-4-14(13)21-15/h1-4,12H,5-11H2 |
| InChIKey | NGQWFXOJUTZRTF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |