C16H23N3O3S — CID 32618855
(2S)-2-[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-2-phenylacetamide (PubChem CID 32618855) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is (2S)-2-[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-2-phenylacetamide.
| Compound Name | (2S)-2-[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 32618855 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (2S)-2-[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]-2-phenylacetamide |
| SMILES | NC(=O)[C@H](c1ccccc1)N1CCN([C@@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C16H23N3O3S/c17-16(20)15(13-4-2-1-3-5-13)19-9-7-18(8-10-19)14-6-11-23(21,22)12-14/h1-5,14-15H,6-12H2,(H2,17,20)/t14-,15+/m1/s1 |
| InChIKey | ULCBMJXHGQGEEX-CABCVRRESA-N |
| XLogP | 0.02 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |