C18H23N3O4S — CID 42652402
2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-(1H-indol-3-yl)acetic acid (PubChem CID 42652402) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-(1H-indol-3-yl)acetic acid.
| Compound Name | 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-(1H-indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 42652402 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-(1H-indol-3-yl)acetic acid |
| SMILES | O=C(O)C(c1c[nH]c2ccccc12)N1CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C18H23N3O4S/c22-18(23)17(15-11-19-16-4-2-1-3-14(15)16)21-8-6-20(7-9-21)13-5-10-26(24,25)12-13/h1-4,11,13,17,19H,5-10,12H2,(H,22,23) |
| InChIKey | HHNVUPPKPJDIPA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |