C15H18ClN3O2S — CID 124890626
3-chloro-2-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]benzonitrile (PubChem CID 124890626) has the molecular formula C15H18ClN3O2S and a molecular weight of 339.85 g/mol. Its IUPAC name is 3-chloro-2-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]benzonitrile.
| Compound Name | 3-chloro-2-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 124890626 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 3-chloro-2-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1cccc(Cl)c1N1CCN([C@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C15H18ClN3O2S/c16-14-3-1-2-12(10-17)15(14)19-7-5-18(6-8-19)13-4-9-22(20,21)11-13/h1-3,13H,4-9,11H2/t13-/m0/s1 |
| InChIKey | XNBXCWYVKMFDJS-ZDUSSCGKSA-N |
| XLogP | 1.52 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |