C15H18FIN2O3S — CID 55686594
[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(4-fluoro-2-iodophenyl)methanone (PubChem CID 55686594) has the molecular formula C15H18FIN2O3S and a molecular weight of 452.29 g/mol. Its IUPAC name is [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(4-fluoro-2-iodophenyl)methanone.
| Compound Name | [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(4-fluoro-2-iodophenyl)methanone |
|---|---|
| PubChem CID | 55686594 |
| Molecular Formula | C15H18FIN2O3S |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(4-fluoro-2-iodophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1I)N1CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C15H18FIN2O3S/c16-11-1-2-13(14(17)9-11)15(20)19-6-4-18(5-7-19)12-3-8-23(21,22)10-12/h1-2,9,12H,3-8,10H2 |
| InChIKey | KLCBDRHFVZRXTD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|