C17H22FN3O5S — CID 18230331
[2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-oxoethyl] 2-amino-4-fluorobenzoate (PubChem CID 18230331) has the molecular formula C17H22FN3O5S and a molecular weight of 399.44 g/mol. Its IUPAC name is [2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-oxoethyl] 2-amino-4-fluorobenzoate.
| Compound Name | [2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-oxoethyl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 18230331 |
| Molecular Formula | C17H22FN3O5S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | [2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-2-oxoethyl] 2-amino-4-fluorobenzoate |
| SMILES | Nc1cc(F)ccc1C(=O)OCC(=O)N1CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C17H22FN3O5S/c18-12-1-2-14(15(19)9-12)17(23)26-10-16(22)21-6-4-20(5-7-21)13-3-8-27(24,25)11-13/h1-2,9,13H,3-8,10-11,19H2 |
| InChIKey | YLIGCLXPVUTNRS-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|