C20H21FN2O5S — CID 41489084
[2-[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-amino-4-fluorobenzoate (PubChem CID 41489084) has the molecular formula C20H21FN2O5S and a molecular weight of 420.46 g/mol. Its IUPAC name is [2-[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-amino-4-fluorobenzoate.
| Compound Name | [2-[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 41489084 |
| Molecular Formula | C20H21FN2O5S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | [2-[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-amino-4-fluorobenzoate |
| SMILES | Nc1cc(F)ccc1C(=O)OCC(=O)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H21FN2O5S/c21-15-6-7-17(18(22)10-15)20(25)28-12-19(24)23(11-14-4-2-1-3-5-14)16-8-9-29(26,27)13-16/h1-7,10,16H,8-9,11-13,22H2/t16-/m0/s1 |
| InChIKey | MJOWATIHYBOPFH-INIZCTEOSA-N |
| XLogP | 1.78 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|