C19H23NO7S — CID 7851681
4-O-[2-[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate (PubChem CID 7851681) has the molecular formula C19H23NO7S and a molecular weight of 409.46 g/mol. Its IUPAC name is 4-O-[2-[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 7851681 |
| Molecular Formula | C19H23NO7S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 4-O-[2-[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)OCC(=O)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H23NO7S/c1-2-26-18(22)8-9-19(23)27-13-17(21)20(12-15-6-4-3-5-7-15)16-10-11-28(24,25)14-16/h3-9,16H,2,10-14H2,1H3/b9-8+/t16-/m0/s1 |
| InChIKey | HIARYRGCTHJQLA-FDMDGMSGSA-N |
| XLogP | 0.86 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|