C24H30BrNO5S — CID 129420593
[2-[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate (PubChem CID 129420593) has the molecular formula C24H30BrNO5S and a molecular weight of 524.48 g/mol. Its IUPAC name is [2-[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate.
| Compound Name | [2-[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 129420593 |
| Molecular Formula | C24H30BrNO5S |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | [2-[benzyl-[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C24H30BrNO5S/c25-24-11-18-8-19(12-24)10-23(9-18,16-24)22(28)31-14-21(27)26(13-17-4-2-1-3-5-17)20-6-7-32(29,30)15-20/h1-5,18-20H,6-16H2/t18-,19-,20+,23?,24?/m1/s1 |
| InChIKey | DLLWHYPYPMNOST-GBIVKLQZSA-N |
| XLogP | 3.48 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|