C13H18N2O4S — CID 47126271
[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(furan-3-yl)methanone (PubChem CID 47126271) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(furan-3-yl)methanone.
| Compound Name | [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 47126271 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(furan-3-yl)methanone |
| SMILES | O=C(c1ccoc1)N1CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C13H18N2O4S/c16-13(11-1-7-19-9-11)15-5-3-14(4-6-15)12-2-8-20(17,18)10-12/h1,7,9,12H,2-6,8,10H2 |
| InChIKey | ZIJPBZOMFHZMBX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |