C21H25N3O3S — CID 71944338
(2-anilinophenyl)-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methanone (PubChem CID 71944338) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is (2-anilinophenyl)-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methanone.
| Compound Name | (2-anilinophenyl)-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 71944338 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (2-anilinophenyl)-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccccc1Nc1ccccc1)N1CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C21H25N3O3S/c25-21(19-8-4-5-9-20(19)22-17-6-2-1-3-7-17)24-13-11-23(12-14-24)18-10-15-28(26,27)16-18/h1-9,18,22H,10-16H2 |
| InChIKey | AZGWLTZLHICYMZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |