C18H26N2O3S — CID 47719992
[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(4-propylphenyl)methanone (PubChem CID 47719992) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(4-propylphenyl)methanone.
| Compound Name | [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(4-propylphenyl)methanone |
|---|---|
| PubChem CID | 47719992 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-(4-propylphenyl)methanone |
| SMILES | CCCc1ccc(C(=O)N2CCN(C3CCS(=O)(=O)C3)CC2)cc1 |
| InChI | InChI=1S/C18H26N2O3S/c1-2-3-15-4-6-16(7-5-15)18(21)20-11-9-19(10-12-20)17-8-13-24(22,23)14-17/h4-7,17H,2-3,8-14H2,1H3 |
| InChIKey | BOHPDVKIUCJBEC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |