C16H19FN4O2S — CID 133383491
3-[4-(6-fluoroquinazolin-4-yl)piperazin-1-yl]thiolane 1,1-dioxide (PubChem CID 133383491) has the molecular formula C16H19FN4O2S and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-[4-(6-fluoroquinazolin-4-yl)piperazin-1-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[4-(6-fluoroquinazolin-4-yl)piperazin-1-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 133383491 |
| Molecular Formula | C16H19FN4O2S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3-[4-(6-fluoroquinazolin-4-yl)piperazin-1-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(N2CCN(c3ncnc4ccc(F)cc34)CC2)C1 |
| InChI | InChI=1S/C16H19FN4O2S/c17-12-1-2-15-14(9-12)16(19-11-18-15)21-6-4-20(5-7-21)13-3-8-24(22,23)10-13/h1-2,9,11,13H,3-8,10H2 |
| InChIKey | BLOHIBMKXGDPFH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |