C16H16FN5 — CID 133275711
6-fluoro-4-(3-pyrazol-1-ylpiperidin-1-yl)quinazoline (PubChem CID 133275711) has the molecular formula C16H16FN5 and a molecular weight of 297.34 g/mol. Its IUPAC name is 6-fluoro-4-(3-pyrazol-1-ylpiperidin-1-yl)quinazoline.
| Compound Name | 6-fluoro-4-(3-pyrazol-1-ylpiperidin-1-yl)quinazoline |
|---|---|
| PubChem CID | 133275711 |
| Molecular Formula | C16H16FN5 |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 6-fluoro-4-(3-pyrazol-1-ylpiperidin-1-yl)quinazoline |
| SMILES | Fc1ccc2ncnc(N3CCCC(n4cccn4)C3)c2c1 |
| InChI | InChI=1S/C16H16FN5/c17-12-4-5-15-14(9-12)16(19-11-18-15)21-7-1-3-13(10-21)22-8-2-6-20-22/h2,4-6,8-9,11,13H,1,3,7,10H2 |
| InChIKey | JZZSTPNERNDQKD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |