C18H18FN5O2 — CID 171702618
6-fluoro-4-[3-(5-methoxypyrimidin-2-yl)oxypiperidin-1-yl]quinazoline (PubChem CID 171702618) has the molecular formula C18H18FN5O2 and a molecular weight of 355.37 g/mol. Its IUPAC name is 6-fluoro-4-[3-(5-methoxypyrimidin-2-yl)oxypiperidin-1-yl]quinazoline.
| Compound Name | 6-fluoro-4-[3-(5-methoxypyrimidin-2-yl)oxypiperidin-1-yl]quinazoline |
|---|---|
| PubChem CID | 171702618 |
| Molecular Formula | C18H18FN5O2 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 6-fluoro-4-[3-(5-methoxypyrimidin-2-yl)oxypiperidin-1-yl]quinazoline |
| SMILES | COc1cnc(OC2CCCN(c3ncnc4ccc(F)cc34)C2)nc1 |
| InChI | InChI=1S/C18H18FN5O2/c1-25-14-8-20-18(21-9-14)26-13-3-2-6-24(10-13)17-15-7-12(19)4-5-16(15)22-11-23-17/h4-5,7-9,11,13H,2-3,6,10H2,1H3 |
| InChIKey | DJWAUCWRMHFHPL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 73.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |