C16H20FN3O2 — CID 133331936
6-fluoro-4-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]quinazoline (PubChem CID 133331936) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is 6-fluoro-4-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]quinazoline.
| Compound Name | 6-fluoro-4-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]quinazoline |
|---|---|
| PubChem CID | 133331936 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 6-fluoro-4-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]quinazoline |
| SMILES | COCCOCC1CCN(c2ncnc3ccc(F)cc23)C1 |
| InChI | InChI=1S/C16H20FN3O2/c1-21-6-7-22-10-12-4-5-20(9-12)16-14-8-13(17)2-3-15(14)18-11-19-16/h2-3,8,11-12H,4-7,9-10H2,1H3 |
| InChIKey | FGUMYMYZFQFUMR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|