C15H18FN3O2 — CID 133429803
6-fluoro-4-[3-(3-methoxypropoxy)azetidin-1-yl]quinazoline (PubChem CID 133429803) has the molecular formula C15H18FN3O2 and a molecular weight of 291.33 g/mol. Its IUPAC name is 6-fluoro-4-[3-(3-methoxypropoxy)azetidin-1-yl]quinazoline.
| Compound Name | 6-fluoro-4-[3-(3-methoxypropoxy)azetidin-1-yl]quinazoline |
|---|---|
| PubChem CID | 133429803 |
| Molecular Formula | C15H18FN3O2 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 6-fluoro-4-[3-(3-methoxypropoxy)azetidin-1-yl]quinazoline |
| SMILES | COCCCOC1CN(c2ncnc3ccc(F)cc23)C1 |
| InChI | InChI=1S/C15H18FN3O2/c1-20-5-2-6-21-12-8-19(9-12)15-13-7-11(16)3-4-14(13)17-10-18-15/h3-4,7,10,12H,2,5-6,8-9H2,1H3 |
| InChIKey | VTJBMZDCXQETRB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|