C22H34N2O — CID 2846303
1-[4-[4-(4-tert-butylcyclohexyl)piperazin-1-yl]phenyl]ethanone (PubChem CID 2846303) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is 1-[4-[4-(4-tert-butylcyclohexyl)piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-(4-tert-butylcyclohexyl)piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 2846303 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | 1-[4-[4-(4-tert-butylcyclohexyl)piperazin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(C3CCC(C(C)(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C22H34N2O/c1-17(25)18-5-9-20(10-6-18)23-13-15-24(16-14-23)21-11-7-19(8-12-21)22(2,3)4/h5-6,9-10,19,21H,7-8,11-16H2,1-4H3 |
| InChIKey | KLCNIKLILHLHJV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |